CAS 30766-27-9 is the registry number for methyl 5-nitronicotinate, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
Methyl 5-nitropyridine-3-carboxylate (CAS 30766-27-9) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: methyl 5-nitropyridine-3-carboxylate. InChIKey: QCOPSULUPWRTSS-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | methyl 5-nitropyridine-3-carboxylate |
| InChIKey | QCOPSULUPWRTSS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)