CAS 29682-14-2 appears in our catalog under these names: Methyl 5-nitropicolinate, 98%, Methyl 5–nitropicolinate, Methyl 5-nitropicolinate, Methyl 5-nitropicolinate 97%, Methyl 5-nitropicolinate, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 250mg, 10g, 100mg.
Methyl 5-nitropyridine-2-carboxylate (CAS 29682-14-2) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: methyl 5-nitropyridine-2-carboxylate. InChIKey: WBJDJRHSHXTRAT-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | methyl 5-nitropyridine-2-carboxylate |
| InChIKey | WBJDJRHSHXTRAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)