Products 6968-22-5
CAS 6968-22-5 appears in our catalog under these names: 3-Amino-4-nitrobenzoic acid, 95%, 3–Amino–4–nitrobenzoic acid, 3-Amino-4-nitrobenzoic acid, 3-Amino-4-nitrobenzoic acid 95%, 3-Amino-4-nitrobenzoic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 250mg, 100mg.
3-amino-4-nitrobenzoic acid (CAS 6968-22-5) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-4-nitrobenzoic acid. InChIKey: LYCCVBLUKJRDOF-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-4-nitrobenzoic acid |
| InChIKey | LYCCVBLUKJRDOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)