Products 1588-83-6
CAS 1588-83-6 appears in our catalog under these names: 4-Amino-3-nitrobenzoic acid, 97%, 4–Amino–3–nitrobenzoic acid, 3-Nitro-4-aminobenzoic acid, 4-Amino-3-nitrobenzoic acid, 98%, 4-Amino-3-nitrobenzoic Acid, >95.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 0,5kg, 2kg, 5kg.
4-amino-3-nitrobenzoic acid (CAS 1588-83-6) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-amino-3-nitrobenzoic acid. InChIKey: ZZNAYFWAXZJITH-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-amino-3-nitrobenzoic acid |
| InChIKey | ZZNAYFWAXZJITH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)