CAS 342618-24-0 appears in our catalog under these names: 2-Methyl-5-nitroisonicotinic acid, 95%, 2-Methyl-5-nitroisonicotinic acid, 97%, 97%, 2-METHYL-5-NITROISONICOTINIC ACID, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
2-methyl-5-nitropyridine-4-carboxylic acid (CAS 342618-24-0) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-methyl-5-nitropyridine-4-carboxylic acid. InChIKey: NUSSTXJBEAIFEV-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine-4-carboxylic acid |
| InChIKey | NUSSTXJBEAIFEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)