CAS 116465-92-0 appears in our catalog under these names: 3-Amino-2-nitrobenzoic acid, 95%, 2-Nitro-3-aminobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-amino-2-nitrobenzoic acid (CAS 116465-92-0) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-2-nitrobenzoic acid. InChIKey: FGMRHNYMZYMARX-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-2-nitrobenzoic acid |
| InChIKey | FGMRHNYMZYMARX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)