CAS 89795-70-0 is the registry number for 2-Amino-3,5-pyridinedicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.
2-aminopyridine-3,5-dicarboxylic acid (CAS 89795-70-0) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-aminopyridine-3,5-dicarboxylic acid. InChIKey: IVLPFCOWTKBYGG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-aminopyridine-3,5-dicarboxylic acid |
| InChIKey | IVLPFCOWTKBYGG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)