CAS 618-84-8 appears in our catalog under these names: 3-Amino-5-nitrobenzoic acid, 98%, 3–Amino–5–nitrobenzoic acid, 3-Amino-5-nitrobenzoic acid, 98% , 3-Amino-5-nitrobenzoic acid, 3-Amino-5-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 50g, 250g, 250mg, 10g.
3-amino-5-nitrobenzoic acid (CAS 618-84-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-5-nitrobenzoic acid. InChIKey: ZNVHAQRPXAQKRU-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-5-nitrobenzoic acid |
| InChIKey | ZNVHAQRPXAQKRU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)