cas: 1849-70-3 — see every product listed under this CAS number, including other names
2-Amino-4,7-dichlorobenzothiazole, 97% (CAS 1849-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033435-100MG |
| cas | 1849-70-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 529.00 Pln | |
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 2.5g | 1716.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,7-dichloro-1,3-benzothiazol-2-amine (CAS 1849-70-3) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 4,7-dichloro-1,3-benzothiazol-2-amine. InChIKey: SVUNGWGACJPVHB-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 4,7-dichloro-1,3-benzothiazol-2-amine |
| InChIKey | SVUNGWGACJPVHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)N=C(S2)N)Cl |
Computed by PubChem (NCBI)