cas: 102293-80-1 — see every product listed under this CAS number, including other names
2-Bromo-1-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)ethanone 95% (CAS 102293-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512492-100mg |
| cas | 102293-80-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1015.62 Pln | |
| Ambeed | 10g | 1727.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A512492 |
2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone (CAS 102293-80-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone. InChIKey: SJYXUPGLQCUYJS-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone |
| InChIKey | SJYXUPGLQCUYJS-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(=O)CBr)C |
Computed by PubChem (NCBI)