cas: 1055331-73-1 — see every product listed under this CAS number, including other names
2-Bromo-5-fluoro-3-nitrobenzoic acid 95% (CAS 1055331-73-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A666850-250mg |
| cas | 1055331-73-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 670.75 Pln | |
| Ambeed | 25g | 1571.88 Pln | |
| Ambeed | 100g | 4636.81 Pln | |
| Ambeed | 500g | 18337.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A666850 |
2-bromo-5-fluoro-3-nitrobenzoic acid (CAS 1055331-73-1) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-5-fluoro-3-nitrobenzoic acid. InChIKey: NECOPMNBEYPKCO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3-nitrobenzoic acid |
| InChIKey | NECOPMNBEYPKCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)