Products 1330750-23-6

CAS 1330750-23-6 is the registry number for 5-Bromo-4-fluoro-2-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-4-fluoro-2-nitrobenzoic acid (CAS 1330750-23-6) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 5-bromo-4-fluoro-2-nitrobenzoic acid. InChIKey: SRAJUIZMZUCXQU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrFNO4
Molecular weight264.00 g/mol
IUPAC name5-bromo-4-fluoro-2-nitrobenzoic acid
InChIKeySRAJUIZMZUCXQU-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)F)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)