Products 1036388-81-4
CAS 1036388-81-4 appears in our catalog under these names: 2-Bromo-6-fluoro-3-nitrobenzoic acid, 95%, 2–Bromo–6–fluoro–3–nitrobenzoic acid, 2-Bromo-6-fluoro-3-nitrobenzoic acid, 2-Bromo-6-fluoro-3-nitrobenzoic acid 95%, 2-Bromo-6-fluoro-3-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25mg, 0,5g, 50mg, 100mg, 5g.
2-bromo-6-fluoro-3-nitrobenzoic acid (CAS 1036388-81-4) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-6-fluoro-3-nitrobenzoic acid. InChIKey: WOFZANBTJXHQEB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-6-fluoro-3-nitrobenzoic acid |
| InChIKey | WOFZANBTJXHQEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Br)C(=O)O)F |
Computed by PubChem (NCBI)