Products 1807025-82-6
CAS 1807025-82-6 appears in our catalog under these names: 4-Bromo-2-fluoro-3-nitrobenzoic acid, 96%, 4-Bromo-2-fluoro-3-nitrobenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-3-nitrobenzoic acid (CAS 1807025-82-6) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-2-fluoro-3-nitrobenzoic acid. InChIKey: VHVZJUGOZVJLBB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-nitrobenzoic acid |
| InChIKey | VHVZJUGOZVJLBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)