Products 1036389-83-9
CAS 1036389-83-9 appears in our catalog under these names: 2-Bromo-4-fluoro-5-nitrobenzoic acid, 97%, 2-Bromo-4-fluoro-5-nitrobenzoic Acid, 2-Bromo-4-fluoro-5-nitrobenzoic acid 98%, Benzoic acid, 2-bromo-4-fluoro-5-nitro-, 98%, 98%, 2-Bromo-4-fluoro-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg, 100g.
2-bromo-4-fluoro-5-nitrobenzoic acid (CAS 1036389-83-9) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-4-fluoro-5-nitrobenzoic acid. InChIKey: APETYHSLTIVOQX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-5-nitrobenzoic acid |
| InChIKey | APETYHSLTIVOQX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)Br)C(=O)O |
Computed by PubChem (NCBI)