Products 1153279-80-1
CAS 1153279-80-1 appears in our catalog under these names: 5-Bromo-2-fluoro-3-nitrobenzoic acid, 98%, 5–Bromo–2–fluoro–3–nitrobenzoic acid, 5-Bromo-2-fluoro-3-nitrobenzoic acid 98%, 5-Bromo-2-fluoro-3-nitrobenzoic Acid, 98%, 98%, 5-Bromo-2-fluoro-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g, 100mg, 50g.
5-bromo-2-fluoro-3-nitrobenzoic acid (CAS 1153279-80-1) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 5-bromo-2-fluoro-3-nitrobenzoic acid. InChIKey: SXOKSXISBYNNQM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-nitrobenzoic acid |
| InChIKey | SXOKSXISBYNNQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)