2-Bromo-5-fluoro-3-nitrobenzoic acid, 95%
cas: 1055331-73-1 — see every product listed under this CAS number, including other names
2-Bromo-5-fluoro-3-nitrobenzoic acid, 95% (CAS 1055331-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238139-1G |
| cas | 1055331-73-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 320.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-fluoro-3-nitrobenzoic acid (CAS 1055331-73-1) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-5-fluoro-3-nitrobenzoic acid. InChIKey: NECOPMNBEYPKCO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3-nitrobenzoic acid |
| InChIKey | NECOPMNBEYPKCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)