CAS 1628556-99-9 appears in our catalog under these names: 3-Bromo-5-fluoro-2-nitrobenzoic acid, 97%, 3-Bromo-5-fluoro-2-nitrobenzoic acid 97%, 3-Bromo-5-fluoro-2-nitrobenzoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-bromo-5-fluoro-2-nitrobenzoic acid (CAS 1628556-99-9) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 3-bromo-5-fluoro-2-nitrobenzoic acid. InChIKey: FSQLAPZDEQXCLJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-nitrobenzoic acid |
| InChIKey | FSQLAPZDEQXCLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)