Products 1055331-73-1
CAS 1055331-73-1 appears in our catalog under these names: 2-Bromo-5-fluoro-3-nitrobenzoic acid, 98%, 2-bromo-5-fluoro-3-nitrobenzoic acid, 2-Bromo-5-fluoro-3-nitrobenzoic acid 95%, 2-Bromo-5-fluoro-3-nitrobenzoicacid, 98%, 98%, 2-Bromo-5-fluoro-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 500g.
2-bromo-5-fluoro-3-nitrobenzoic acid (CAS 1055331-73-1) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 2-bromo-5-fluoro-3-nitrobenzoic acid. InChIKey: NECOPMNBEYPKCO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3-nitrobenzoic acid |
| InChIKey | NECOPMNBEYPKCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)