cas: 2005-43-8 — see every product listed under this CAS number, including other names
2-Bromoquinoline, 96%, 96% (CAS 2005-43-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CTM-250mg |
| cas | 2005-43-8 |
| size | 250mg |
| availability | 179.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 100g | 899.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-bromoquinoline (CAS 2005-43-8) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 2-bromoquinoline. InChIKey: QKJAZPHKNWSXDF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 2-bromoquinoline |
| InChIKey | QKJAZPHKNWSXDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)Br |
Computed by PubChem (NCBI)