CAS 16567-18-3 appears in our catalog under these names: 8–Bromoquinoline, 8-Bromoquinoline, 98% , 8-Bromoquinoline, >95.0%(GC)(T), 8-Bromoquinoline 97%, 8-Bromoquinoline, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g, 1000g, 1kg.
8-bromoquinoline (CAS 16567-18-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoquinoline. InChIKey: PIWNKSHCLTZKSZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoquinoline |
| InChIKey | PIWNKSHCLTZKSZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CC=C2 |
Computed by PubChem (NCBI)