CAS 63927-22-0 appears in our catalog under these names: 8-Bromoisoquinoline, >97.0%(GC)(T), 8-Bromoisoquinoline, 8-Bromoisoquinoline, 97%, 8-Bromoisoquinoline 98%, 8-Bromoisoquinoline, 99.96%. Offered by: TCI, Biosynth, Thermo Scientific (Acros), Ambeed, MedChemExpress. Available pack sizes: 1g, 5g, 100g, 250g, 500g, 1000g, 250mg, 10g.
8-bromoisoquinoline (CAS 63927-22-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoisoquinoline. InChIKey: DPRIHFQFWWCIGY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoisoquinoline |
| InChIKey | DPRIHFQFWWCIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)Br |
Computed by PubChem (NCBI)