CAS 5332-24-1 appears in our catalog under these names: 3-Bromoquinoline, 3-Bromoquinoline/ 98%, 3–Bromoquinoline, 3-Bromoquinoline, 98% , 3-Bromoquinoline, 98%. Offered by: TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 25g, 5g, 50g, 250g, 500g, 100g, 1000g.
3-bromoquinoline (CAS 5332-24-1) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 3-bromoquinoline. InChIKey: ZGIKWINFUGEQEO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 3-bromoquinoline |
| InChIKey | ZGIKWINFUGEQEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)