CAS 34784-04-8 appears in our catalog under these names: 5–Bromoisoquinoline, 5-Bromoisoquinoline, >96.0%(GC)(T), 5-Bromoisoquinoline 98%, 5-Bromoisoquinoline, 98%, 98%, 5-Bromoisoquinoline, 99.95%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 500mg, 10g, 25g, 100g, 500g, 50g.
5-bromoisoquinoline (CAS 34784-04-8) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 5-bromoisoquinoline. InChIKey: CYJZJGYYTFQQBY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 5-bromoisoquinoline |
| InChIKey | CYJZJGYYTFQQBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)Br |
Computed by PubChem (NCBI)