CAS 5332-25-2 appears in our catalog under these names: 6-Bromoquinoline, 98%, 6-Bromoquinoline, 6–Bromoquinoline, 6-Bromoquinoline, 97% , 6-Bromoquinoline, >95.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1g, 50g, 250g.
6-bromoquinoline (CAS 5332-25-2) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 6-bromoquinoline. InChIKey: IFIHYLCUKYCKRH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 6-bromoquinoline |
| InChIKey | IFIHYLCUKYCKRH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)N=C1 |
Computed by PubChem (NCBI)