CAS 4964-71-0 appears in our catalog under these names: 5–Bromoquinoline, 5-Bromoquinoline, 97% , 5-Bromoquinoline, >98.0%(GC)(T), 5-Bromoquinoline 97%, 5-BROMOQUINOLINE, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 10g, 500g, 25 g.
5-bromoquinoline (CAS 4964-71-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 5-bromoquinoline. InChIKey: CHODTZCXWXCALP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 5-bromoquinoline |
| InChIKey | CHODTZCXWXCALP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=N2)C(=C1)Br |
Computed by PubChem (NCBI)