CAS 3964-04-3 appears in our catalog under these names: 4-Bromoquinoline 95%, 4-BROMOQUINOLINE, 4-Bromoquinoline, 97%, 97%, 4-Bromoquinoline, 98%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g.
4-bromoquinoline (CAS 3964-04-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 4-bromoquinoline. InChIKey: SUXIPCHEUMEUSV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 4-bromoquinoline |
| InChIKey | SUXIPCHEUMEUSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)Br |
Computed by PubChem (NCBI)