CAS 4965-36-0 appears in our catalog under these names: 7-Bromoquinoline, 95% , 7-Bromoquinoline, >98.0%(GC)(T), 7-Bromoquinoline, 7-Bromoquinoline 98%, 7-bromoquinoline, 98%, 98%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 1000g, 500g.
7-bromoquinoline (CAS 4965-36-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 7-bromoquinoline. InChIKey: XYBSZCUHOLWQQU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 7-bromoquinoline |
| InChIKey | XYBSZCUHOLWQQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)N=C1 |
Computed by PubChem (NCBI)