2-Chloro-3-fluorobenzenesulfonamide, 95%
cas: 1065102-82-0 — see every product listed under this CAS number, including other names
2-Chloro-3-fluorobenzenesulfonamide, 95% (CAS 1065102-82-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A782482-50mg |
| cas | 1065102-82-0 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 342.56 Pln | |
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2295.00 Pln | |
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2330.00 Pln | |
| BLDpharm | 50mg | 353.23 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 941.92 Pln | |
| BLDpharm | 1g | 2419.17 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-3-fluorobenzenesulfonamide (CAS 1065102-82-0) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 2-chloro-3-fluorobenzenesulfonamide. InChIKey: JOXFIGJVJLSXHB-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzenesulfonamide |
| InChIKey | JOXFIGJVJLSXHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)N)Cl)F |
Computed by PubChem (NCBI)