CAS 146533-46-2 is the registry number for 3-Chloro-4-fluorobenzenesulfonamide, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-chloro-4-fluorobenzenesulfonamide (CAS 146533-46-2) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 3-chloro-4-fluorobenzenesulfonamide. InChIKey: KKVQDRHEXRGIMI-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 3-chloro-4-fluorobenzenesulfonamide |
| InChIKey | KKVQDRHEXRGIMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)F |
Computed by PubChem (NCBI)