Products 2166649-66-5

CAS 2166649-66-5 is the registry number for 6-Fluoro-4-methyl-pyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-fluoro-4-methylpyridine-3-sulfonyl chloride (CAS 2166649-66-5) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 6-fluoro-4-methylpyridine-3-sulfonyl chloride. InChIKey: JVYFSIHCUFQKHS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClFNO2S
Molecular weight209.63 g/mol
IUPAC name6-fluoro-4-methylpyridine-3-sulfonyl chloride
InChIKeyJVYFSIHCUFQKHS-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1S(=O)(=O)Cl)F

Computed by PubChem (NCBI)