CAS 1384431-40-6 appears in our catalog under these names: (6-Chloropyridin-3-yl)methanesulfonyl fluoride, (6-Chloropyridin-3-yl)methanesulfonyl fluoride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 10g, 100mg, 1g.
(6-chloro-3-pyridinyl)methanesulfonyl fluoride (CAS 1384431-40-6) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: (6-chloro-3-pyridinyl)methanesulfonyl fluoride. InChIKey: WLGBSPHYTCCDMQ-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | (6-chloro-3-pyridinyl)methanesulfonyl fluoride |
| InChIKey | WLGBSPHYTCCDMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CS(=O)(=O)F)Cl |
Computed by PubChem (NCBI)