CAS 1996-51-6 appears in our catalog under these names: 4-Amino-3-chlorobenzene-1-sulfonyl fluoride, 98%, 4-Amino-3-chlorobenzene-1-sulfonyl fluoride 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg.
4-amino-3-chlorobenzenesulfonyl fluoride (CAS 1996-51-6) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 4-amino-3-chlorobenzenesulfonyl fluoride. InChIKey: PYRUUCYNAXPEBA-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 4-amino-3-chlorobenzenesulfonyl fluoride |
| InChIKey | PYRUUCYNAXPEBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)F)Cl)N |
Computed by PubChem (NCBI)