Products 612548-20-6

CAS 612548-20-6 is the registry number for 3-Amino-4-fluorobenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-amino-4-fluorobenzenesulfonyl chloride (CAS 612548-20-6) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 3-amino-4-fluorobenzenesulfonyl chloride. InChIKey: FOYGIZOTWJGYSN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClFNO2S
Molecular weight209.63 g/mol
IUPAC name3-amino-4-fluorobenzenesulfonyl chloride
InChIKeyFOYGIZOTWJGYSN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)N)F

Computed by PubChem (NCBI)