Products 2412605-17-3

CAS 2412605-17-3 is the registry number for 5-Fluoro-6-methylpyridine-2-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

5-fluoro-6-methylpyridine-2-sulfonyl chloride (CAS 2412605-17-3) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 5-fluoro-6-methylpyridine-2-sulfonyl chloride. InChIKey: LPMOWDZSFJKWJK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClFNO2S
Molecular weight209.63 g/mol
IUPAC name5-fluoro-6-methylpyridine-2-sulfonyl chloride
InChIKeyLPMOWDZSFJKWJK-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=N1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)