CAS 1208077-16-0 is the registry number for 2-Chloro-5-fluorobenzene sulfonamide, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 500mg, 1g, 2.5g.
2-chloro-5-fluorobenzenesulfonamide (CAS 1208077-16-0) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 2-chloro-5-fluorobenzenesulfonamide. InChIKey: YAYZQLYBTWWZTG-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-chloro-5-fluorobenzenesulfonamide |
| InChIKey | YAYZQLYBTWWZTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)