Products 2505373-53-3
CAS 2505373-53-3 is the registry number for 5-Fluoro-2-methylpyridine-3-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-methylpyridine-3-sulfonyl chloride (CAS 2505373-53-3) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 5-fluoro-2-methylpyridine-3-sulfonyl chloride. InChIKey: INISHYJAKQDYSO-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 5-fluoro-2-methylpyridine-3-sulfonyl chloride |
| InChIKey | INISHYJAKQDYSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)