cas: 279252-26-5 — see every product listed under this CAS number, including other names
2-Chloro-4-(trifluoromethyl)benzyl bromide, 95% (CAS 279252-26-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QG-9394-250mg |
| cas | 279252-26-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 3101.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene (CAS 279252-26-5) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene. InChIKey: AIZUUFYFLNVTQX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 1-(bromomethyl)-2-chloro-4-(trifluoromethyl)benzene |
| InChIKey | AIZUUFYFLNVTQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)CBr |
Computed by PubChem (NCBI)