cas: 151104-21-1 — see every product listed under this CAS number, including other names
2-Chloro-5-(pyrrolidin-1-ylsulfonyl)benzoic acid, 97% (CAS 151104-21-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A214860-5g |
| cas | 151104-21-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14372.47 Pln | |
| AmBeed | 10g | 21312.13 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-5-pyrrolidin-1-ylsulfonylbenzoic acid (CAS 151104-21-1) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoic acid. InChIKey: SVUWNNIOERGNJG-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoic acid |
| InChIKey | SVUWNNIOERGNJG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)