CAS 73096-27-2 appears in our catalog under these names: 1-[(4-Chlorophenyl)sulfonyl]-2-pyrrolidinecarboxylic acid, 95%, (2S)–1–((4–Chlorophenyl)sulfonyl)–2–pyrrolidinecarboxylic acid, 1-((4-Chlorophenyl)sulfonyl)pyrrolidine-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 500mg, 100mg.
1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 73096-27-2) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: JXMXHRZHMZMBDK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | JXMXHRZHMZMBDK-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)