Products 927996-03-0

CAS 927996-03-0 is the registry number for 4-Chloro-3-(1,1-dioxido-1,2-thiazinan-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoic acid (CAS 927996-03-0) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoic acid. InChIKey: RIXSJOHKJMEPTD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO4S
Molecular weight289.74 g/mol
IUPAC name4-chloro-3-(1,1-dioxothiazinan-2-yl)benzoic acid
InChIKeyRIXSJOHKJMEPTD-UHFFFAOYSA-N
SMILESC1CCS(=O)(=O)N(C1)C2=C(C=CC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)