Products 887129-69-3

CAS 887129-69-3 is the registry number for 2-Chloro-4-(1,1-dioxido-1,2-thiazinan-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid (CAS 887129-69-3) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid. InChIKey: LUIBZWXZBWILST-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO4S
Molecular weight289.74 g/mol
IUPAC name2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid
InChIKeyLUIBZWXZBWILST-UHFFFAOYSA-N
SMILESC1CCS(=O)(=O)N(C1)C2=CC(=C(C=C2)C(=O)O)Cl

Computed by PubChem (NCBI)