CAS 887129-69-3 is the registry number for 2-Chloro-4-(1,1-dioxido-1,2-thiazinan-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid (CAS 887129-69-3) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid. InChIKey: LUIBZWXZBWILST-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 2-chloro-4-(1,1-dioxothiazinan-2-yl)benzoic acid |
| InChIKey | LUIBZWXZBWILST-UHFFFAOYSA-N |
| SMILES | C1CCS(=O)(=O)N(C1)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)