CAS 2140316-98-7 is the registry number for 2-Ethyl-6-methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethyl-6-methyl-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride (CAS 2140316-98-7) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-ethyl-6-methyl-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride. InChIKey: XAXYWJAXZCVTNO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 2-ethyl-6-methyl-3-oxo-4H-1,4-benzoxazine-7-sulfonyl chloride |
| InChIKey | XAXYWJAXZCVTNO-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(O1)C=C(C(=C2)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)