CAS 744203-97-2 appears in our catalog under these names: 2-(N-(Prop-2-en-1-yl)4-chlorobenzenesulfonamido)acetic acid, 95%, (Allyl[(4-chlorophenyl)sulfonyl]amino)acetic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetic acid (CAS 744203-97-2) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetic acid. InChIKey: AZGQALIAMDAIST-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]acetic acid |
| InChIKey | AZGQALIAMDAIST-UHFFFAOYSA-N |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)