CAS 1016503-60-8 is the registry number for 2-(Morpholine-4-carbonyl)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(morpholine-4-carbonyl)benzenesulfonyl chloride (CAS 1016503-60-8) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 2-(morpholine-4-carbonyl)benzenesulfonyl chloride. InChIKey: SGSVXCYRAPMQTB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 2-(morpholine-4-carbonyl)benzenesulfonyl chloride |
| InChIKey | SGSVXCYRAPMQTB-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)