Products 1955523-95-1
CAS 1955523-95-1 is the registry number for 7-Methoxy-1-oxo-2,3,4,5-tetrahydro-1H-2-benzazepine-8-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-methoxy-1-oxo-2,3,4,5-tetrahydro-2-benzazepine-8-sulfonyl chloride (CAS 1955523-95-1) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: 7-methoxy-1-oxo-2,3,4,5-tetrahydro-2-benzazepine-8-sulfonyl chloride. InChIKey: PZDONKKBAGOMRQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | 7-methoxy-1-oxo-2,3,4,5-tetrahydro-2-benzazepine-8-sulfonyl chloride |
| InChIKey | PZDONKKBAGOMRQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCCNC2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)