Products 650617-50-8
CAS 650617-50-8 is the registry number for ethyl 2-{[1-(4-chlorophenyl)-1-methyl-1-oxo-lambda-6-sulphanylidene]amino}-2-oxoacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[[(4-chlorophenyl)-methyl-oxo-lambda6-sulfanylidene]amino]-2-oxoacetate (CAS 650617-50-8) is a chemical compound with the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. IUPAC name: ethyl 2-[[(4-chlorophenyl)-methyl-oxo-lambda6-sulfanylidene]amino]-2-oxoacetate. InChIKey: KUVZDCSFHUBBRY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | ethyl 2-[[(4-chlorophenyl)-methyl-oxo-lambda6-sulfanylidene]amino]-2-oxoacetate |
| InChIKey | KUVZDCSFHUBBRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)N=S(=O)(C)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)