cas: 886500-26-1 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)benzyl bromide, 97% (CAS 886500-26-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049658-250MG |
| cas | 886500-26-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 633.13 Pln | |
| Fluorochem | 25g | 1320.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene (CAS 886500-26-1) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene. InChIKey: FSQANOAIVKWIEU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-3-(trifluoromethyl)benzene |
| InChIKey | FSQANOAIVKWIEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CBr)C(F)(F)F |
Computed by PubChem (NCBI)