Products 1159512-62-5
CAS 1159512-62-5 appears in our catalog under these names: 2–fluoro–3–(trifluoromethoxy)benzoic acid, 2-Fluoro-3-(trifluoromethoxy)benzoic acid, 98%, 98%, 2-FLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 100g.
2-fluoro-3-(trifluoromethoxy)benzoic acid (CAS 1159512-62-5) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethoxy)benzoic acid. InChIKey: VUFVRYWIHCPNGN-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | VUFVRYWIHCPNGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)