CAS 886496-49-7 appears in our catalog under these names: 4-Fluoro-3-(trifluoromethoxy)benzoic acid, 96%, 4-Fluoro-3-(trifluoromethoxy)benzoic acid 98%, 4-FLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 100mg.
4-fluoro-3-(trifluoromethoxy)benzoic acid (CAS 886496-49-7) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 4-fluoro-3-(trifluoromethoxy)benzoic acid. InChIKey: PTPKGMXRSREZFB-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 4-fluoro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | PTPKGMXRSREZFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)OC(F)(F)F)F |
Computed by PubChem (NCBI)